WormBase Tree Display for Molecule: WBMol:00003650
expand all nodes | collapse all nodes | view schema
| WBMol:00003650 | Public_name | aldicarb | ||||
|---|---|---|---|---|---|---|
| Formula | C7H14N2O2S | |||||
| Monoisotopic_mass | 190.078 | |||||
| IUPAC | 2-methyl-N-[(methylcarbamoyl)oxy]-2-(methylsulfanyl)propan-1-imine | |||||
| SMILES | [H]C(=NOC(=O)NC)C(C)(C)SC | |||||
| InChi | InChI=1S/C7H14N2O2S/c1-7(2,12-4)5-9-11-6(10)8-3/h5H,1-4H3,(H,8,10) | |||||
| InChiKey | QGLZXHRNAYXIBU-UHFFFAOYSA-N | |||||
| Synonym (12) | ||||||
| DB_info | Database | NLM_MeSH | UID | D000448 | ||
| CTD | ChemicalID | D000448 | ||||
| ChEBI | CHEBI_ID | 2555 | ||||
| ChemIDplus | RN | 116-06-3 | ||||
| KEGG COMPOUND | Accession_number | C11015 | ||||
| Biofunction_role | Inhibitor | Paper_evidence | WBPaper00039786 | |||
| WBPaper00000464 | ||||||
| WBPaper00040375 | ||||||
| WBPaper00002167 | ||||||
| WBPaper00053832 | ||||||
| Remark | inhibits the enzyme that breaks down acetylcholine thereby activating cholinergic receptors | |||||
| Regulate_expr_cluster | WBPaper00038061:aldicarb_downregulated | |||||
| WBPaper00038061:aldicarb_upregulated | ||||||
| Affects_phenotype_of | Variation (169) | |||||
| Transgene (16) | ||||||
| RNAi | WBRNAi00082243 | WBPhenotype:0000016 | Paper_evidence | WBPaper00036228 | ||
| WBRNAi00095152 | WBPhenotype:0000017 | Paper_evidence | WBPaper00036653 | |||
| WBRNAi00095153 | WBPhenotype:0000017 | Paper_evidence | WBPaper00036653 | |||
| WBRNAi00117277 | WBPhenotype:0000016 | Paper_evidence | WBPaper00064672 | |||
| Disease_info | Induces_disease | DOID:700 | ||||
| DOID:10595 | ||||||
| DOID:11724 | ||||||
| DOID:0050709 | ||||||
| DOID:0060041 | ||||||
| Disease_model_inducer (14) | ||||||
| Molecule_use | acetylcholinesterase inhibitor | insecticide | acaricide | nematocide | |||||
| Reference | WBPaper00039786 | |||||
| WBPaper00000464 | ||||||
| WBPaper00040375 | ||||||
| WBPaper00002167 | ||||||
| WBPaper00053832 |
